| MolName | [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| MolecularFormula | C20H13N4O6Cl |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\c(cc1)ccc1OC(c1cccc(Cl)c1)=O)=O |
| InChI | InChI=1S/C20H13ClN4O6/c21-15-3-1-2-14(10-15)20(26)31-17-7-4-13(5-8-17)12-22-23-18-9-6-16(24(27)28)11-19(18)25(29)30/h1-12,23H |
| InChIK | WPCZIGKQEQNUID-UHFFFAOYSA-N |
| TotalMolweight | 440.798 |
| Molweight | 440.798 |
| MonoisotopicMass | 440.052363 |
| CLogP | 5.0342 |
| CLogS | -6.275 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 319.51 |
| Relative PSA | 0.33442 |
| PolarSurfaceArea | 142.33 |
| Druglikeness | -3.3011 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate | 2 - [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] 3-chlorobenzoate