| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]aniline |
| MolecularFormula | C13H11N2F |
| Smiles | Fc1c(/C=N\Nc2ccccc2)cccc1 |
| InChI | InChI=1S/C13H11FN2/c14-13-9-5-4-6-11(13)10-15-16-12-7-2-1-3-8-12/h1-10,16H |
| InChIK | WPFIBPMJEYJGMZ-UHFFFAOYSA-N |
| TotalMolweight | 214.242 |
| Molweight | 214.242 |
| MonoisotopicMass | 214.090626 |
| CLogP | 4.9417 |
| CLogS | -3.463 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 175.59 |
| Relative PSA | 0.13082 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 1.0825 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]aniline | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]aniline