| MolName | 3,5-dibromo-N-[(Z)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-4-hydroxybenzamide |
| MolecularFormula | C18H10N4O3Br2ClF |
| Smiles | Oc(c(Br)cc(C(N/N=C\c(cc1)ccc1Oc1nc(Cl)ncc1F)=O)c1)c1Br |
| InChI | InChI=1S/C18H10Br2ClFN4O3/c19-12-5-10(6-13(20)15(12)27)16(28)26-24-7-9-1-3-11(4-2-9)29-17-14(22)8-23-18(21)25-17/h1-8,27H,(H,26,28) |
| InChIK | WPKFVDZICFMOBZ-UHFFFAOYSA-N |
| TotalMolweight | 544.561 |
| Molweight | 544.561 |
| MonoisotopicMass | 541.879218 |
| CLogP | 5.439 |
| CLogS | -7.73 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 319.65 |
| Relative PSA | 0.25356 |
| PolarSurfaceArea | 96.7 |
| Druglikeness | 1.1785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dibromo-N-[(Z)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-4-hydroxybenzamide | 2 - 3,5-dibromo-N-[(Z)-[4-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-4-hydroxybenzamide