| MolName | [3-[(Z)-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| MolecularFormula | C31H21N4O5ClS |
| Smiles | O=C(C(N/N=C\c1cccc(OC(c(sc2c3cccc2)c3Cl)=O)c1)=O)Nc(cccc1)c1C(Nc1ccccc1)=O |
| InChI | InChI=1S/C31H21ClN4O5S/c32-26-23-14-5-7-16-25(23)42-27(26)31(40)41-21-12-8-9-19(17-21)18-33-36-30(39)29(38)35-24-15-6-4-13-22(24)28(37)34-20-10-2-1-3-11-20/h1-18H,(H,34,37)(H,35,38)(H,36,39) |
| InChIK | WPXKVGPTNMANQL-UHFFFAOYSA-N |
| TotalMolweight | 597.05 |
| Molweight | 597.05 |
| MonoisotopicMass | 596.092118 |
| CLogP | 6.2491 |
| CLogS | -8.592 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 438.64 |
| Relative PSA | 0.29275 |
| PolarSurfaceArea | 154.2 |
| Druglikeness | 4.648 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide; 3-halo-enone |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate | 2 - [3-[(Z)-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate