| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-pyrrol-1-ylbenzamide |
| MolecularFormula | C19H15N3O3 |
| Smiles | O=C(c(cccc1)c1-n1cccc1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C19H15N3O3/c23-19(15-5-1-2-6-16(15)22-9-3-4-10-22)21-20-12-14-7-8-17-18(11-14)25-13-24-17/h1-12H,13H2,(H,21,23) |
| InChIK | WPZFOQCNMQMZEX-UHFFFAOYSA-N |
| TotalMolweight | 333.346 |
| Molweight | 333.346 |
| MonoisotopicMass | 333.111342 |
| CLogP | 3.4979 |
| CLogS | -6.745 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 256.21 |
| Relative PSA | 0.24542 |
| PolarSurfaceArea | 64.85 |
| Druglikeness | 4.9168 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-pyrrol-1-ylbenzamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-pyrrol-1-ylbenzamide