| MolName | N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| MolecularFormula | C19H15N3O4F2S2 |
| Smiles | O=C(c(cc1)ccc1NS(c1cccs1)(=O)=O)N/N=C\c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C19H15F2N3O4S2/c20-19(21)28-16-9-3-13(4-10-16)12-22-23-18(25)14-5-7-15(8-6-14)24-30(26,27)17-2-1-11-29-17/h1-12,19,24H,(H,23,25) |
| InChIK | WQLFBMXATDXIJJ-UHFFFAOYSA-N |
| TotalMolweight | 451.473 |
| Molweight | 451.473 |
| MonoisotopicMass | 451.047203 |
| CLogP | 3.6592 |
| CLogS | -5.593 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 317.93 |
| Relative PSA | 0.3347 |
| PolarSurfaceArea | 133.48 |
| Druglikeness | 3.863 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide | 2 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide