| MolName | N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide |
| MolecularFormula | C26H21N2O4F |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C\c1ccc(-c(cc2)ccc2F)o1 |
| InChI | InChI=1S/C26H21FN2O4/c27-21-8-6-20(7-9-21)25-15-14-24(33-25)16-28-29-26(30)18-32-23-12-10-22(11-13-23)31-17-19-4-2-1-3-5-19/h1-16H,17-18H2,(H,29,30) |
| InChIK | WQNUZYHYEDGEEJ-UHFFFAOYSA-N |
| TotalMolweight | 444.461 |
| Molweight | 444.461 |
| MonoisotopicMass | 444.148536 |
| CLogP | 5.1643 |
| CLogS | -6.616 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 350.07 |
| Relative PSA | 0.2003 |
| PolarSurfaceArea | 73.06 |
| Druglikeness | 5.0603 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide | 2 - N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide