| MolName | 3-(4-nitrophenyl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-one |
| MolecularFormula | C15H10N6O5 |
| Smiles | [O-][N+](c1ccc(/C=N\N(C(c(cc2)ccc2[N+]([O-])=O)=NN2)C2=O)cc1)=O |
| InChI | InChI=1S/C15H10N6O5/c22-15-18-17-14(11-3-7-13(8-4-11)21(25)26)19(15)16-9-10-1-5-12(6-2-10)20(23)24/h1-9H,(H,18,22) |
| InChIK | WQXQQZYSAJQZFY-UHFFFAOYSA-N |
| TotalMolweight | 354.281 |
| Molweight | 354.281 |
| MonoisotopicMass | 354.071269 |
| CLogP | 1.0913 |
| CLogS | -5.287 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 254.1 |
| Relative PSA | 0.44042 |
| PolarSurfaceArea | 148.7 |
| Druglikeness | -0.58646 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-nitrophenyl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-one | 2 - 3-(4-nitrophenyl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-one