| MolName | 5-bromo-N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C21H12N3O3Br |
| Smiles | N#Cc(cc1)ccc1-c1ccc(/C=N\NC(c2cc(cc(cc3)Br)c3o2)=O)o1 |
| InChI | InChI=1S/C21H12BrN3O3/c22-16-5-7-19-15(9-16)10-20(28-19)21(26)25-24-12-17-6-8-18(27-17)14-3-1-13(11-23)2-4-14/h1-10,12H,(H,25,26) |
| InChIK | WRCXKMOHLQFAMJ-UHFFFAOYSA-N |
| TotalMolweight | 434.248 |
| Molweight | 434.248 |
| MonoisotopicMass | 433.006203 |
| CLogP | 5.2069 |
| CLogS | -7.971 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 301.07 |
| Relative PSA | 0.25838 |
| PolarSurfaceArea | 91.53 |
| Druglikeness | 0.57774 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-bromo-N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - 5-bromo-N-[(Z)-[5-(4-cyanophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide