| MolName | 4-chloro-N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| MolecularFormula | C23H16N4OClF |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1F |
| InChI | InChI=1S/C23H16ClFN4O/c24-19-10-6-17(7-11-19)23(30)27-26-14-18-15-29(21-4-2-1-3-5-21)28-22(18)16-8-12-20(25)13-9-16/h1-15H,(H,27,30) |
| InChIK | WRIOBUMZKXELRQ-UHFFFAOYSA-N |
| TotalMolweight | 418.858 |
| Molweight | 418.858 |
| MonoisotopicMass | 418.099666 |
| CLogP | 4.8274 |
| CLogS | -6.284 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 316.24 |
| Relative PSA | 0.17028 |
| PolarSurfaceArea | 59.28 |
| Druglikeness | 4.5839 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide