| MolName | N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-3,4-dichlorobenzamide |
| MolecularFormula | C25H17N2O2BrCl2 |
| Smiles | O=C(c(cc1)cc(Cl)c1Cl)N/N=C\c(c1ccccc1cc1)c1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C25H17BrCl2N2O2/c26-19-6-3-4-16(12-19)15-32-24-11-9-17-5-1-2-7-20(17)21(24)14-29-30-25(31)18-8-10-22(27)23(28)13-18/h1-14H,15H2,(H,30,31) |
| InChIK | WRMQGIFWXQXGOL-UHFFFAOYSA-N |
| TotalMolweight | 528.232 |
| Molweight | 528.232 |
| MonoisotopicMass | 525.985043 |
| CLogP | 7.6813 |
| CLogS | -8.974 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 354.58 |
| Relative PSA | 0.12976 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.2614 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-3,4-dichlorobenzamide | 2 - N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-3,4-dichlorobenzamide