| MolName | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C22H17N3O3BrF3S |
| Smiles | O=C(CN(c(cc1)ccc1Br)S(c1ccccc1)(=O)=O)N/N=C\c1cc(C(F)(F)F)ccc1 |
| InChI | InChI=1S/C22H17BrF3N3O3S/c23-18-9-11-19(12-10-18)29(33(31,32)20-7-2-1-3-8-20)15-21(30)28-27-14-16-5-4-6-17(13-16)22(24,25)26/h1-14H,15H2,(H,28,30) |
| InChIK | WRNRMLXEYQCTKJ-UHFFFAOYSA-N |
| TotalMolweight | 540.359 |
| Molweight | 540.359 |
| MonoisotopicMass | 539.012607 |
| CLogP | 4.6243 |
| CLogS | -6.538 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 347.48 |
| Relative PSA | 0.1961 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -10.106 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide