| MolName | 4-fluoro-N-[(1E,3E)-5-(4-fluorophenyl)iminopenta-1,3-dienyl]aniline |
| MolecularFormula | C17H14N2F2 |
| Smiles | Fc(cc1)ccc1N/C=C/C=C/C=N/c(cc1)ccc1F |
| InChI | InChI=1S/C17H14F2N2/c18-14-4-8-16(9-5-14)20-12-2-1-3-13-21-17-10-6-15(19)7-11-17/h1-13,20H |
| InChIK | WRTHMRUHGLIQNU-UHFFFAOYSA-N |
| TotalMolweight | 284.308 |
| Molweight | 284.308 |
| MonoisotopicMass | 284.112504 |
| CLogP | 3.0806 |
| CLogS | -4.336 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 234.94 |
| Relative PSA | 0.09777 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | -1.0058 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.80952 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-fluoro-N-[(1E,3E)-5-(4-fluorophenyl)iminopenta-1,3-dienyl]aniline | 2 - 4-fluoro-N-[(1E,3E)-5-(4-fluorophenyl)iminopenta-1,3-dienyl]aniline