| MolName | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide |
| MolecularFormula | C16H12N2O4Cl2 |
| Smiles | O=C(COc1cc(Cl)ccc1)N/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C16H12Cl2N2O4/c17-11-2-1-3-12(5-11)22-8-16(21)20-19-7-10-4-14-15(6-13(10)18)24-9-23-14/h1-7H,8-9H2,(H,20,21) |
| InChIK | WRTMGTPJWVTBKU-UHFFFAOYSA-N |
| TotalMolweight | 367.187 |
| Molweight | 367.187 |
| MonoisotopicMass | 366.017412 |
| CLogP | 4.0999 |
| CLogS | -5.684 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 261.85 |
| Relative PSA | 0.25209 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 4.1711 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide | 2 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide