| MolName | 3-chloro-N-[(Z)-[4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl]methylideneamino]-1-benzothiophene-2-carboxamide |
| MolecularFormula | C26H16N4O2Cl2S2 |
| Smiles | O=C(c(sc1c2cccc1)c2Cl)N/N=C\c1ccc(/C=N\NC(c(sc2c3cccc2)c3Cl)=O)cc1 |
| InChI | InChI=1S/C26H16Cl2N4O2S2/c27-21-17-5-1-3-7-19(17)35-23(21)25(33)31-29-13-15-9-11-16(12-10-15)14-30-32-26(34)24-22(28)18-6-2-4-8-20(18)36-24/h1-14H,(H,31,33)(H,32,34) |
| InChIK | WRZDOPKMGMCKJU-UHFFFAOYSA-N |
| TotalMolweight | 551.477 |
| Molweight | 551.477 |
| MonoisotopicMass | 550.00917 |
| CLogP | 7.798 |
| CLogS | -9.996 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 392.64 |
| Relative PSA | 0.28713 |
| PolarSurfaceArea | 139.4 |
| Druglikeness | 5.6013 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[(Z)-[4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl]methylideneamino]-1-benzothiophene-2-carboxamide | 2 - 3-chloro-N-[(Z)-[4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl]methylideneamino]-1-benzothiophene-2-carboxamide