| MolName | N-[5-[2-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C18H14N6O4S |
| Smiles | [O-][N+](c1cccc(/C=N/NC(Cc2nnc(NC(c3ccccc3)=O)s2)=O)c1)=O |
| InChI | InChI=1S/C18H14N6O4S/c25-15(21-19-11-12-5-4-8-14(9-12)24(27)28)10-16-22-23-18(29-16)20-17(26)13-6-2-1-3-7-13/h1-9,11H,10H2,(H,21,25)(H,20,23,26) |
| InChIK | WSTGQAASPTWLQR-UHFFFAOYSA-N |
| TotalMolweight | 410.413 |
| Molweight | 410.413 |
| MonoisotopicMass | 410.079724 |
| CLogP | 2.2686 |
| CLogS | -4.865 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 306.85 |
| Relative PSA | 0.43419 |
| PolarSurfaceArea | 170.4 |
| Druglikeness | 1.4073 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - N-[5-[2-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide