| MolName | 2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H20N7OF |
| Smiles | Fc1cc(/C=N\Nc2nc(N3CCOCC3)nc(Nc3ccccc3)n2)ccc1 |
| InChI | InChI=1S/C20H20FN7O/c21-16-6-4-5-15(13-16)14-22-27-19-24-18(23-17-7-2-1-3-8-17)25-20(26-19)28-9-11-29-12-10-28/h1-8,13-14H,9-12H2,(H2,23,24,25,26,27) |
| InChIK | WTFLKDFPEKNHTP-UHFFFAOYSA-N |
| TotalMolweight | 393.425 |
| Molweight | 393.425 |
| MonoisotopicMass | 393.171336 |
| CLogP | 5.5627 |
| CLogS | -5.33 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 304.93 |
| Relative PSA | 0.26527 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | 2.0859 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine