| MolName | N-[(Z)-cyclohexylmethylideneamino]furan-2-carboxamide |
| MolecularFormula | C12H16N2O2 |
| Smiles | O=C(c1ccco1)N/N=C\C1CCCCC1 |
| InChI | InChI=1S/C12H16N2O2/c15-12(11-7-4-8-16-11)14-13-9-10-5-2-1-3-6-10/h4,7-10H,1-3,5-6H2,(H,14,15) |
| InChIK | WTGAZNSKPDAQQA-UHFFFAOYSA-N |
| TotalMolweight | 220.271 |
| Molweight | 220.271 |
| MonoisotopicMass | 220.121178 |
| CLogP | 1.9797 |
| CLogS | -3.481 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 184.72 |
| Relative PSA | 0.27133 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | -0.39672 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-cyclohexylmethylideneamino]furan-2-carboxamide | 2 - N-[(Z)-cyclohexylmethylideneamino]furan-2-carboxamide