| MolName | [(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| MolecularFormula | C15H14N3OFS |
| Smiles | NC(N/N=C\c1cc(OCc(cccc2)c2F)ccc1)=S |
| InChI | InChI=1S/C15H14FN3OS/c16-14-7-2-1-5-12(14)10-20-13-6-3-4-11(8-13)9-18-19-15(17)21/h1-9H,10H2,(H3,17,19,21) |
| InChIK | WTTORJDQCCOTKX-UHFFFAOYSA-N |
| TotalMolweight | 303.36 |
| Molweight | 303.36 |
| MonoisotopicMass | 303.08416 |
| CLogP | 2.9809 |
| CLogS | -4.553 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 240.58 |
| Relative PSA | 0.3169 |
| PolarSurfaceArea | 91.73 |
| Druglikeness | 0.46 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea | 2 - [(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]thiourea