| MolName | N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide |
| MolecularFormula | C24H26N4O3 |
| Smiles | O=C(C(N/N=C\c1c(cccc2)c2cc2ccccc12)=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C24H26N4O3/c29-23(25-10-5-11-28-12-14-31-15-13-28)24(30)27-26-17-22-20-8-3-1-6-18(20)16-19-7-2-4-9-21(19)22/h1-4,6-9,16-17H,5,10-15H2,(H,25,29)(H,27,30) |
| InChIK | WTZGJHZKBDIETO-UHFFFAOYSA-N |
| TotalMolweight | 418.495 |
| Molweight | 418.495 |
| MonoisotopicMass | 418.200491 |
| CLogP | 2.9472 |
| CLogS | -4.99 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 328.76 |
| Relative PSA | 0.22527 |
| PolarSurfaceArea | 83.03 |
| Druglikeness | 4.9708 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 9 |
| Symmetricatoms | 8 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide | 2 - N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide