| MolName | N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide |
| MolecularFormula | C25H21N6OCl2F3S |
| Smiles | O=C(c1csc(-n2nc(C(F)(F)F)cc2-c2ccccc2)n1)N/N=C\c(cc1)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C25H21Cl2F3N6OS/c26-10-12-35(13-11-27)19-8-6-17(7-9-19)15-31-33-23(37)20-16-38-24(32-20)36-21(18-4-2-1-3-5-18)14-22(34-36)25(28,29)30/h1-9,14-16H,10-13H2,(H,33,37) |
| InChIK | WUDAHPBLWKMPNB-UHFFFAOYSA-N |
| TotalMolweight | 581.449 |
| Molweight | 581.449 |
| MonoisotopicMass | 580.082667 |
| CLogP | 5.9209 |
| CLogS | -6.42 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 414.81 |
| Relative PSA | 0.21391 |
| PolarSurfaceArea | 103.65 |
| Druglikeness | -2.0093 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 9 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide | 2 - N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxamide