| MolName | 2-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C28H27N7OCl2 |
| Smiles | Clc1cc(Cl)c(COc2cc(/C=N\Nc3nc(N4CCCCC4)nc(Nc4ccccc4)n3)ccc2)cc1 |
| InChI | InChI=1S/C28H27Cl2N7O/c29-22-13-12-21(25(30)17-22)19-38-24-11-7-8-20(16-24)18-31-36-27-33-26(32-23-9-3-1-4-10-23)34-28(35-27)37-14-5-2-6-15-37/h1,3-4,7-13,16-18H,2,5-6,14-15,19H2,(H2,32,33,34,35,36) |
| InChIK | WUDFVVMIMIYDQH-UHFFFAOYSA-N |
| TotalMolweight | 548.476 |
| Molweight | 548.476 |
| MonoisotopicMass | 547.165412 |
| CLogP | 9.186 |
| CLogS | -8.718 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 416.7 |
| Relative PSA | 0.19412 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | 2.375 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine