| MolName | N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]benzenesulfonamide |
| MolecularFormula | C23H25N3O3S |
| Smiles | O=S(c1ccccc1)(N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCOCC1)=O |
| InChI | InChI=1S/C23H25N3O3S/c27-30(28,22-9-5-2-6-10-22)25-24-18-21-12-11-20(17-19-7-3-1-4-8-19)23(21)26-13-15-29-16-14-26/h1-10,17-18,25H,11-16H2 |
| InChIK | WUYGGPZAZLALNW-UHFFFAOYSA-N |
| TotalMolweight | 423.536 |
| Molweight | 423.536 |
| MonoisotopicMass | 423.161662 |
| CLogP | 2.8566 |
| CLogS | -2.482 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 321.31 |
| Relative PSA | 0.20261 |
| PolarSurfaceArea | 79.38 |
| Druglikeness | -4.8286 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]benzenesulfonamide | 2 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]benzenesulfonamide