| MolName | 2-(2-phenoxyethoxy)-N-[(Z)-pyridin-3-ylmethylideneamino]benzamide |
| MolecularFormula | C21H19N3O3 |
| Smiles | O=C(c(cccc1)c1OCCOc1ccccc1)N/N=C\c1cnccc1 |
| InChI | InChI=1S/C21H19N3O3/c25-21(24-23-16-17-7-6-12-22-15-17)19-10-4-5-11-20(19)27-14-13-26-18-8-2-1-3-9-18/h1-12,15-16H,13-14H2,(H,24,25) |
| InChIK | WVBSJCYYGOJEJD-UHFFFAOYSA-N |
| TotalMolweight | 361.4 |
| Molweight | 361.4 |
| MonoisotopicMass | 361.142642 |
| CLogP | 3.5557 |
| CLogS | -4.194 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 293.03 |
| Relative PSA | 0.22858 |
| PolarSurfaceArea | 72.81 |
| Druglikeness | -2.8595 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-phenoxyethoxy)-N-[(Z)-pyridin-3-ylmethylideneamino]benzamide | 2 - 2-(2-phenoxyethoxy)-N-[(Z)-pyridin-3-ylmethylideneamino]benzamide