| MolName | (8S)-6-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| MolecularFormula | C25H19N5O5 |
| Smiles | [O-][N+](c1cc(-c2ccc(/C=N\N(CC(N(C3)[C@H]4Cc5c3[nH]c3c5cccc3)=O)C4=O)o2)ccc1)=O |
| InChI | InChI=1S/C25H19N5O5/c31-24-14-29(26-12-17-8-9-23(35-17)15-4-3-5-16(10-15)30(33)34)25(32)22-11-19-18-6-1-2-7-20(18)27-21(19)13-28(22)24/h1-10,12,22,27H,11,13-14H2/t22-/m0/s1 |
| InChIK | WVFNIYRPVXJFKC-QFIPXVFZSA-N |
| TotalMolweight | 469.456 |
| Molweight | 469.456 |
| MonoisotopicMass | 469.13862 |
| CLogP | 1.8318 |
| CLogS | -5.516 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 337.95 |
| Relative PSA | 0.3054 |
| PolarSurfaceArea | 127.73 |
| Druglikeness | 4.4344 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (8S)-6-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione | 2 - (8S)-6-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione