| MolName | 1-(1,3-diphenylpyrazol-4-yl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]urea |
| MolecularFormula | C21H16N6O4 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(Nc2cn(-c3ccccc3)nc2-c2ccccc2)=O)o1)=O |
| InChI | InChI=1S/C21H16N6O4/c28-21(24-22-13-17-11-12-19(31-17)27(29)30)23-18-14-26(16-9-5-2-6-10-16)25-20(18)15-7-3-1-4-8-15/h1-14H,(H2,23,24,28) |
| InChIK | WVIJZIMDXCEGCJ-UHFFFAOYSA-N |
| TotalMolweight | 416.396 |
| Molweight | 416.396 |
| MonoisotopicMass | 416.123304 |
| CLogP | 2.733 |
| CLogS | -6.417 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 319.29 |
| Relative PSA | 0.34401 |
| PolarSurfaceArea | 130.27 |
| Druglikeness | 3.9793 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(1,3-diphenylpyrazol-4-yl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]urea | 2 - 1-(1,3-diphenylpyrazol-4-yl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]urea