| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| MolecularFormula | C24H22N3O5ClS |
| Smiles | O=C(CN(CCc1ccccc1)S(c(cc1)ccc1Cl)(=O)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C24H22ClN3O5S/c25-20-7-9-21(10-8-20)34(30,31)28(13-12-18-4-2-1-3-5-18)16-24(29)27-26-15-19-6-11-22-23(14-19)33-17-32-22/h1-11,14-15H,12-13,16-17H2,(H,27,29) |
| InChIK | WWBCJSIJIPUFFL-UHFFFAOYSA-N |
| TotalMolweight | 499.974 |
| Molweight | 499.974 |
| MonoisotopicMass | 499.096869 |
| CLogP | 4.6307 |
| CLogS | -5.504 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 362.59 |
| Relative PSA | 0.24308 |
| PolarSurfaceArea | 105.68 |
| Druglikeness | 7.6942 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide