| MolName | N-[(Z)-[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylideneamino]pyridine-4-carboxamide |
| MolecularFormula | C15H14N4O4S |
| Smiles | [O-][N+](c(cc(/C=N\NC(c1ccncc1)=O)cc1)c1SCCO)=O |
| InChI | InChI=1S/C15H14N4O4S/c20-7-8-24-14-2-1-11(9-13(14)19(22)23)10-17-18-15(21)12-3-5-16-6-4-12/h1-6,9-10,20H,7-8H2,(H,18,21) |
| InChIK | WWLUVARKNQSICF-UHFFFAOYSA-N |
| TotalMolweight | 346.366 |
| Molweight | 346.366 |
| MonoisotopicMass | 346.073576 |
| CLogP | 1.3266 |
| CLogS | -3.959 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 260.78 |
| Relative PSA | 0.4141 |
| PolarSurfaceArea | 145.7 |
| Druglikeness | -0.56243 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylideneamino]pyridine-4-carboxamide | 2 - N-[(Z)-[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylideneamino]pyridine-4-carboxamide