| MolName | N-benzyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide |
| MolecularFormula | C18H17N3O2Cl2 |
| Smiles | O=C(CCC(N/N=C\c(ccc(Cl)c1)c1Cl)=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-15-7-6-14(16(20)10-15)12-22-23-18(25)9-8-17(24)21-11-13-4-2-1-3-5-13/h1-7,10,12H,8-9,11H2,(H,21,24)(H,23,25) |
| InChIK | WWQVKLRTMZIEIL-UHFFFAOYSA-N |
| TotalMolweight | 378.258 |
| Molweight | 378.258 |
| MonoisotopicMass | 377.069781 |
| CLogP | 3.9741 |
| CLogS | -5.353 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 288.32 |
| Relative PSA | 0.20987 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 3.9841 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-benzyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide | 2 - N-benzyl-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide