| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
| MolecularFormula | C18H15N4O2Cl |
| Smiles | O=C(CCC1=Nc(cccc2)c2NC1=O)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C18H15ClN4O2/c19-13-6-2-1-5-12(13)11-20-23-17(24)10-9-16-18(25)22-15-8-4-3-7-14(15)21-16/h1-8,11H,9-10H2,(H,22,25)(H,23,24) |
| InChIK | WWRPZWLYRWABCF-UHFFFAOYSA-N |
| TotalMolweight | 354.796 |
| Molweight | 354.796 |
| MonoisotopicMass | 354.088353 |
| CLogP | 2.7573 |
| CLogS | -4.855 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 268.61 |
| Relative PSA | 0.26812 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 5.5393 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide