| MolName | N-[(Z)-thiophen-3-ylmethylideneamino]-3-(trifluoromethyl)benzamide |
| MolecularFormula | C13H9N2OF3S |
| Smiles | O=C(c1cc(C(F)(F)F)ccc1)N/N=C\c1cscc1 |
| InChI | InChI=1S/C13H9F3N2OS/c14-13(15,16)11-3-1-2-10(6-11)12(19)18-17-7-9-4-5-20-8-9/h1-8H,(H,18,19) |
| InChIK | WWUJFXZBYDTBNK-UHFFFAOYSA-N |
| TotalMolweight | 298.287 |
| Molweight | 298.287 |
| MonoisotopicMass | 298.038767 |
| CLogP | 3.8343 |
| CLogS | -4.399 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 212.39 |
| Relative PSA | 0.26541 |
| PolarSurfaceArea | 69.7 |
| Druglikeness | -2.2724 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-3-ylmethylideneamino]-3-(trifluoromethyl)benzamide | 2 - N-[(Z)-thiophen-3-ylmethylideneamino]-3-(trifluoromethyl)benzamide