| MolName | N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-nitrobenzamide |
| MolecularFormula | C18H12N3O4Cl |
| Smiles | [O-][N+](c1cccc(C(N/N=C\c2ccc(-c(cccc3)c3Cl)o2)=O)c1)=O |
| InChI | InChI=1S/C18H12ClN3O4/c19-16-7-2-1-6-15(16)17-9-8-14(26-17)11-20-21-18(23)12-4-3-5-13(10-12)22(24)25/h1-11H,(H,21,23) |
| InChIK | WWWVNULXAWYCMA-UHFFFAOYSA-N |
| TotalMolweight | 369.763 |
| Molweight | 369.763 |
| MonoisotopicMass | 369.051634 |
| CLogP | 3.8249 |
| CLogS | -6.377 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 275.53 |
| Relative PSA | 0.29231 |
| PolarSurfaceArea | 100.42 |
| Druglikeness | 1.4137 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-nitrobenzamide | 2 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-nitrobenzamide