| MolName | N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C25H19N2O3Cl |
| Smiles | Oc(cccc1)c1C(N/N=C\c(c1ccccc1cc1)c1OCc(cccc1)c1Cl)=O |
| InChI | InChI=1S/C25H19ClN2O3/c26-22-11-5-2-8-18(22)16-31-24-14-13-17-7-1-3-9-19(17)21(24)15-27-28-25(30)20-10-4-6-12-23(20)29/h1-15,29H,16H2,(H,28,30) |
| InChIK | WXADZTYZFJKEEF-UHFFFAOYSA-N |
| TotalMolweight | 430.89 |
| Molweight | 430.89 |
| MonoisotopicMass | 430.10842 |
| CLogP | 6.0044 |
| CLogS | -7.108 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 326.88 |
| Relative PSA | 0.18083 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.0392 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-hydroxybenzamide