| MolName | [(Z)-[5-nitro-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea |
| MolecularFormula | C19H20N4O5 |
| Smiles | C=CCc(cccc1)c1OCCOc(cc1)c(/C=N\NC(N)=O)cc1[N+]([O-])=O |
| InChI | InChI=1S/C19H20N4O5/c1-2-5-14-6-3-4-7-17(14)27-10-11-28-18-9-8-16(23(25)26)12-15(18)13-21-22-19(20)24/h2-4,6-9,12-13H,1,5,10-11H2,(H3,20,22,24) |
| InChIK | WXDDRVZXGJFMCR-UHFFFAOYSA-N |
| TotalMolweight | 384.391 |
| Molweight | 384.391 |
| MonoisotopicMass | 384.143371 |
| CLogP | 2.5971 |
| CLogS | -5.254 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 305 |
| Relative PSA | 0.33344 |
| PolarSurfaceArea | 131.76 |
| Druglikeness | -10.879 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[5-nitro-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea | 2 - [(Z)-[5-nitro-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea