| MolName | N-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| MolecularFormula | C20H16N8O3S |
| Smiles | [O-][N+](c(cc1)ccc1-c(c(/C=N\NC(CSc1ncn[nH]1)=O)c1)nn1-c1ccccc1)=O |
| InChI | InChI=1S/C20H16N8O3S/c29-18(12-32-20-21-13-23-25-20)24-22-10-15-11-27(16-4-2-1-3-5-16)26-19(15)14-6-8-17(9-7-14)28(30)31/h1-11,13H,12H2,(H,24,29)(H,21,23,25) |
| InChIK | WXINJXRIUYPPKC-UHFFFAOYSA-N |
| TotalMolweight | 448.466 |
| Molweight | 448.466 |
| MonoisotopicMass | 448.106607 |
| CLogP | 1.4238 |
| CLogS | -4.955 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 336.48 |
| Relative PSA | 0.40921 |
| PolarSurfaceArea | 171.97 |
| Druglikeness | 1.5147 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide | 2 - N-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide