| MolName | N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]aniline |
| MolecularFormula | C27H24N2O2 |
| Smiles | C(c1ccccc1)Oc(ccc(/C=N\Nc1ccccc1)c1)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H24N2O2/c1-4-10-22(11-5-1)20-30-26-17-16-24(19-28-29-25-14-8-3-9-15-25)18-27(26)31-21-23-12-6-2-7-13-23/h1-19,29H,20-21H2 |
| InChIK | WXNSBPDEURUXBH-UHFFFAOYSA-N |
| TotalMolweight | 408.5 |
| Molweight | 408.5 |
| MonoisotopicMass | 408.183778 |
| CLogP | 7.5371 |
| CLogS | -5.831 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 336.28 |
| Relative PSA | 0.12778 |
| PolarSurfaceArea | 42.85 |
| Druglikeness | 1.6288 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]aniline | 2 - N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]aniline