| MolName | N-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C21H14N2O3Br2Cl2 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(cc1Br)cc(Br)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C21H14Br2Cl2N2O3/c22-16-7-12(10-26-27-21(29)15-3-1-2-4-19(15)28)8-17(23)20(16)30-11-13-5-6-14(24)9-18(13)25/h1-10,28H,11H2,(H,27,29) |
| InChIK | WXSNHKKHQZNNRK-UHFFFAOYSA-N |
| TotalMolweight | 573.067 |
| Molweight | 573.067 |
| MonoisotopicMass | 569.874819 |
| CLogP | 6.8664 |
| CLogS | -7.906 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 344.96 |
| Relative PSA | 0.17135 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 2.2492 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide