| MolName | 3-amino-N-[(Z)-furan-2-ylmethylideneamino]pyrazine-2-carboxamide |
| MolecularFormula | C10H9N5O2 |
| Smiles | Nc1nccnc1C(N/N=C\c1ccco1)=O |
| InChI | InChI=1S/C10H9N5O2/c11-9-8(12-3-4-13-9)10(16)15-14-6-7-2-1-5-17-7/h1-6H,(H2,11,13)(H,15,16) |
| InChIK | WXWFKTCRHHDZGX-UHFFFAOYSA-N |
| TotalMolweight | 231.214 |
| Molweight | 231.214 |
| MonoisotopicMass | 231.075625 |
| CLogP | 0.1166 |
| CLogS | -2.438 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 182.72 |
| Relative PSA | 0.47794 |
| PolarSurfaceArea | 106.4 |
| Druglikeness | 4.1246 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-amino-N-[(Z)-furan-2-ylmethylideneamino]pyrazine-2-carboxamide | 2 - 3-amino-N-[(Z)-furan-2-ylmethylideneamino]pyrazine-2-carboxamide