| MolName | (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-1-phenylethanone |
| MolecularFormula | C14H10N2OCl2 |
| Smiles | O=C(/C=N\Nc(ccc(Cl)c1)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-11-6-7-13(12(16)8-11)18-17-9-14(19)10-4-2-1-3-5-10/h1-9,18H |
| InChIK | WYEMQJUGHQUXHP-UHFFFAOYSA-N |
| TotalMolweight | 293.152 |
| Molweight | 293.152 |
| MonoisotopicMass | 292.017017 |
| CLogP | 4.8518 |
| CLogS | -4.689 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 217.83 |
| Relative PSA | 0.16531 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.5475 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-1-phenylethanone | 2 - (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-1-phenylethanone