| MolName | [(Z)-[3-(4-bromophenyl)-1-(2-cyanoethyl)pyrazol-4-yl]methylideneamino]thiourea |
| MolecularFormula | C14H13N6BrS |
| Smiles | NC(N/N=C\c1cn(CCC#N)nc1-c(cc1)ccc1Br)=S |
| InChI | InChI=1S/C14H13BrN6S/c15-12-4-2-10(3-5-12)13-11(8-18-19-14(17)22)9-21(20-13)7-1-6-16/h2-5,8-9H,1,7H2,(H3,17,19,22) |
| InChIK | WYHUOAPUTIIPIK-UHFFFAOYSA-N |
| TotalMolweight | 377.269 |
| Molweight | 377.269 |
| MonoisotopicMass | 376.010575 |
| CLogP | 2.0257 |
| CLogS | -4.7 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 266.29 |
| Relative PSA | 0.36667 |
| PolarSurfaceArea | 124.11 |
| Druglikeness | -4.2268 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[3-(4-bromophenyl)-1-(2-cyanoethyl)pyrazol-4-yl]methylideneamino]thiourea | 2 - [(Z)-[3-(4-bromophenyl)-1-(2-cyanoethyl)pyrazol-4-yl]methylideneamino]thiourea