| MolName | N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C11H7N2OF5 |
| Smiles | O=C(C1CC1)N/N=C\c(c(F)c(c(F)c1F)F)c1F |
| InChI | InChI=1S/C11H7F5N2O/c12-6-5(3-17-18-11(19)4-1-2-4)7(13)9(15)10(16)8(6)14/h3-4H,1-2H2,(H,18,19) |
| InChIK | WYOKFWUMLXIJPY-UHFFFAOYSA-N |
| TotalMolweight | 278.18 |
| Molweight | 278.18 |
| MonoisotopicMass | 278.047853 |
| CLogP | 2.5799 |
| CLogS | -4.637 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 185.5 |
| Relative PSA | 0.19412 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.3808 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]cyclopropanecarboxamide