| MolName | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| MolecularFormula | C24H21N3O5Br2S |
| Smiles | O=C(CN(CCc1ccccc1)S(c(cc1)ccc1Br)(=O)=O)N/N=C\c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C24H21Br2N3O5S/c25-19-6-8-20(9-7-19)35(31,32)29(11-10-17-4-2-1-3-5-17)15-24(30)28-27-14-18-12-22-23(13-21(18)26)34-16-33-22/h1-9,12-14H,10-11,15-16H2,(H,28,30) |
| InChIK | WYPBBDLPONAOBI-UHFFFAOYSA-N |
| TotalMolweight | 623.321 |
| Molweight | 623.321 |
| MonoisotopicMass | 620.956864 |
| CLogP | 5.4751 |
| CLogS | -6.436 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 384.43 |
| Relative PSA | 0.22927 |
| PolarSurfaceArea | 105.68 |
| Druglikeness | 5.2795 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide | 2 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide