| MolName | 3-morpholin-4-ylsulfonyl-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C24H23N3O5S |
| Smiles | O=C(c1cccc(S(N2CCOCC2)(=O)=O)c1)N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C24H23N3O5S/c28-24(20-7-5-11-23(17-20)33(29,30)27-12-14-31-15-13-27)26-25-18-19-6-4-10-22(16-19)32-21-8-2-1-3-9-21/h1-11,16-18H,12-15H2,(H,26,28) |
| InChIK | WYSTVAYKFQZUFW-UHFFFAOYSA-N |
| TotalMolweight | 465.529 |
| Molweight | 465.529 |
| MonoisotopicMass | 465.135842 |
| CLogP | 3.64 |
| CLogS | -5.224 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 347.17 |
| Relative PSA | 0.25388 |
| PolarSurfaceArea | 105.68 |
| Druglikeness | 0.36475 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-morpholin-4-ylsulfonyl-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide | 2 - 3-morpholin-4-ylsulfonyl-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide