| MolName | N-[(Z)-pyridin-4-ylmethylideneamino]-2H-tetrazol-5-amine |
| MolecularFormula | C7H7N7 |
| Smiles | C(c1ccncc1)=N\Nc1n[nH]nn1 |
| InChI | InChI=1S/C7H7N7/c1-3-8-4-2-6(1)5-9-10-7-11-13-14-12-7/h1-5H,(H2,10,11,12,13,14) |
| InChIK | WYXVZRKMNWBMJO-UHFFFAOYSA-N |
| TotalMolweight | 189.182 |
| Molweight | 189.182 |
| MonoisotopicMass | 189.076293 |
| CLogP | 1.8329 |
| CLogS | -1.762 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 153.85 |
| Relative PSA | 0.52545 |
| PolarSurfaceArea | 91.74 |
| Druglikeness | -1.4144 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-pyridin-4-ylmethylideneamino]-2H-tetrazol-5-amine | 2 - N-[(Z)-pyridin-4-ylmethylideneamino]-2H-tetrazol-5-amine