| MolName | 4-[(Z)-(oxamoylhydrazinylidene)methyl]benzoate |
| MolecularFormula | C10H8N3O4 |
| Smiles | NC(C(N/N=C\c(cc1)ccc1C([O-])=O)=O)=O |
| InChI | InChI=1S/C10H9N3O4/c11-8(14)9(15)13-12-5-6-1-3-7(4-2-6)10(16)17/h1-5H,(H2,11,14)(H,13,15)(H,16,17)/p-1 |
| InChIK | WZJIVZYLZALTJR-UHFFFAOYSA-M |
| TotalMolweight | 234.191 |
| Molweight | 234.191 |
| MonoisotopicMass | 234.051482 |
| CLogP | -2.5072 |
| CLogS | -2.115 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 178.78 |
| Relative PSA | 0.51259 |
| PolarSurfaceArea | 124.68 |
| Druglikeness | 2.2794 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(oxamoylhydrazinylidene)methyl]benzoate | 2 - 4-[(Z)-(oxamoylhydrazinylidene)methyl]benzoate