| MolName | 4-[(Z)-anthracen-9-ylmethylideneamino]-2-[(2-chlorophenyl)methyl]-1,2,4-triazole-3-thione |
| MolecularFormula | C24H17N4ClS |
| Smiles | S=C(N(Cc(cccc1)c1Cl)N=C1)N1/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C24H17ClN4S/c25-23-12-6-3-9-19(23)15-28-24(30)29(16-27-28)26-14-22-20-10-4-1-7-17(20)13-18-8-2-5-11-21(18)22/h1-14,16H,15H2 |
| InChIK | WZLJJSJOBRHVFH-UHFFFAOYSA-N |
| TotalMolweight | 428.946 |
| Molweight | 428.946 |
| MonoisotopicMass | 428.086243 |
| CLogP | 6.0791 |
| CLogS | -8.216 |
| H Acceptors | 4 |
| TotalSurfaceArea | 320.73 |
| Relative PSA | 0.18121 |
| PolarSurfaceArea | 63.29 |
| Druglikeness | 3.922 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-anthracen-9-ylmethylideneamino]-2-[(2-chlorophenyl)methyl]-1,2,4-triazole-3-thione | 2 - 4-[(Z)-anthracen-9-ylmethylideneamino]-2-[(2-chlorophenyl)methyl]-1,2,4-triazole-3-thione