| MolName | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-naphthalen-2-yloxyacetamide |
| MolecularFormula | C23H17N2O3Cl |
| Smiles | O=C(COc1cc2ccccc2cc1)N/N=C\c1ccc(-c(cc2)ccc2Cl)o1 |
| InChI | InChI=1S/C23H17ClN2O3/c24-19-8-5-17(6-9-19)22-12-11-21(29-22)14-25-26-23(27)15-28-20-10-7-16-3-1-2-4-18(16)13-20/h1-14H,15H2,(H,26,27) |
| InChIK | WZPYCYYXHANAEL-UHFFFAOYSA-N |
| TotalMolweight | 404.852 |
| Molweight | 404.852 |
| MonoisotopicMass | 404.09277 |
| CLogP | 5.5158 |
| CLogS | -7.303 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 310.22 |
| Relative PSA | 0.1938 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 6.4337 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-naphthalen-2-yloxyacetamide | 2 - N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2-naphthalen-2-yloxyacetamide