| MolName | [2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenyl] 2-nitrobenzenesulfonate |
| MolecularFormula | C15H11N5O5S |
| Smiles | [O-][N+](c(cccc1)c1S(Oc1c(/C=N\n2cnnc2)cccc1)(=O)=O)=O |
| InChI | InChI=1S/C15H11N5O5S/c21-20(22)13-6-2-4-8-15(13)26(23,24)25-14-7-3-1-5-12(14)9-18-19-10-16-17-11-19/h1-11H |
| InChIK | XAEXPOSAUPSWDR-UHFFFAOYSA-N |
| TotalMolweight | 373.348 |
| Molweight | 373.348 |
| MonoisotopicMass | 373.04809 |
| CLogP | 1.1856 |
| CLogS | -5.544 |
| H Acceptors | 10 |
| TotalSurfaceArea | 266.51 |
| Relative PSA | 0.41019 |
| PolarSurfaceArea | 140.64 |
| Druglikeness | -4.0639 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenyl] 2-nitrobenzenesulfonate | 2 - [2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenyl] 2-nitrobenzenesulfonate