| MolName | (1R)-N-[(Z)-benzylideneamino]-2,2-diphenylcyclopropane-1-carboxamide |
| MolecularFormula | C23H20N2O |
| Smiles | O=C([C@H](C1)C1(c1ccccc1)c1ccccc1)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c26-22(25-24-17-18-10-4-1-5-11-18)21-16-23(21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17,21H,16H2,(H,25,26)/t21-/m0/s1 |
| InChIK | XAIUDMBDIPEQPV-NRFANRHFSA-N |
| TotalMolweight | 340.425 |
| Molweight | 340.425 |
| MonoisotopicMass | 340.157563 |
| CLogP | 4.8078 |
| CLogS | -4.702 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 269.92 |
| Relative PSA | 0.13341 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.6169 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1R)-N-[(Z)-benzylideneamino]-2,2-diphenylcyclopropane-1-carboxamide | 2 - (1R)-N-[(Z)-benzylideneamino]-2,2-diphenylcyclopropane-1-carboxamide