| MolName | 5-N,6-N-bis[(Z)-(4-bromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| MolecularFormula | C18H12N8OBr2 |
| Smiles | Brc1ccc(/C=N\Nc2nc3nonc3nc2N/N=C\c(cc2)ccc2Br)cc1 |
| InChI | InChI=1S/C18H12Br2N8O/c19-13-5-1-11(2-6-13)9-21-25-15-16(24-18-17(23-15)27-29-28-18)26-22-10-12-3-7-14(20)8-4-12/h1-10H,(H,23,25,27)(H,24,26,28) |
| InChIK | XAQWMNIYNXMRDA-UHFFFAOYSA-N |
| TotalMolweight | 516.156 |
| Molweight | 516.156 |
| MonoisotopicMass | 513.950079 |
| CLogP | 8.6901 |
| CLogS | -7.139 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 321.81 |
| Relative PSA | 0.32295 |
| PolarSurfaceArea | 113.48 |
| Druglikeness | 1.5875 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 16 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 5-N,6-N-bis[(Z)-(4-bromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine | 2 - 5-N,6-N-bis[(Z)-(4-bromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine